CAS 2185-98-0 is the registry number for Ocaphane. Offered by: MedChemExpress. Available pack sizes: Get quote.
[2-(2-azaniumyl-2-carboxyethyl)phenyl]methyl-bis(2-chloroethyl)azanium dichloride (CAS 2185-98-0) is a chemical compound with the molecular formula C14H22Cl4N2O2 and a molecular weight of 392.1 g/mol. IUPAC name: [2-(2-azaniumyl-2-carboxyethyl)phenyl]methyl-bis(2-chloroethyl)azanium dichloride. InChIKey: IPIMPKPAJIIOMJ-UHFFFAOYSA-N.
| Molecular formula | C14H22Cl4N2O2 |
|---|---|
| Molecular weight | 392.1 g/mol |
| IUPAC name | [2-(2-azaniumyl-2-carboxyethyl)phenyl]methyl-bis(2-chloroethyl)azanium dichloride |
| InChIKey | IPIMPKPAJIIOMJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(C(=O)O)[NH3+])C[NH+](CCCl)CCCl.[Cl-].[Cl-] |
Computed by PubChem (NCBI)