CAS 21851-89-8 is the registry number for 1,1,3,5,5-Pentaphenyl-1,3,5-triphosphapentane trioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
[diphenylphosphanylmethyl(phenyl)phosphoryl]methyl-diphenylphosphane (CAS 21851-89-8) is a chemical compound with the molecular formula C32H29OP3 and a molecular weight of 522.5 g/mol. IUPAC name: [diphenylphosphanylmethyl(phenyl)phosphoryl]methyl-diphenylphosphane. InChIKey: NENOPSPISCHXLK-UHFFFAOYSA-N.
| Molecular formula | C32H29OP3 |
|---|---|
| Molecular weight | 522.5 g/mol |
| IUPAC name | [diphenylphosphanylmethyl(phenyl)phosphoryl]methyl-diphenylphosphane |
| InChIKey | NENOPSPISCHXLK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(CP(=O)(CP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)