CAS 2185792-87-2 is the registry number for 4-Hydroxyphenylacetonitrile-d4. Offered by: TRC. Available pack sizes: 5mg.
2-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)acetonitrile (CAS 2185792-87-2) is a chemical compound with the molecular formula C8H7NO and a molecular weight of 137.17 g/mol. IUPAC name: 2-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)acetonitrile. InChIKey: AYKYOOPFBCOXSL-RHQRLBAQSA-N.
| Molecular formula | C8H7NO |
|---|---|
| Molecular weight | 137.17 g/mol |
| IUPAC name | 2-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)acetonitrile |
| InChIKey | AYKYOOPFBCOXSL-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CC#N)[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)