Products 2185863-14-1

CAS 2185863-14-1 is the registry number for 5–fluoro SDB–005. Offered by: GLPBio. Available pack sizes: 1mg, 10mg, 5mg.

Structural formula: {0} (CAS {1})

Naphthalen-1-yl 1-(5-fluoropentyl)indazole-3-carboxylate (CAS 2185863-14-1) is a chemical compound with the molecular formula C23H21FN2O2 and a molecular weight of 376.4 g/mol. IUPAC name: naphthalen-1-yl 1-(5-fluoropentyl)indazole-3-carboxylate. InChIKey: FNMFGMMHNFDPNT-UHFFFAOYSA-N.

Identity
Molecular formulaC23H21FN2O2
Molecular weight376.4 g/mol
IUPAC namenaphthalen-1-yl 1-(5-fluoropentyl)indazole-3-carboxylate
InChIKeyFNMFGMMHNFDPNT-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=CC=C2OC(=O)C3=NN(C4=CC=CC=C43)CCCCCF

Computed by PubChem (NCBI)