CAS 218614-13-2 is the registry number for (-)-Methyl (3S)-3,5-Bis-{(tert-butyldimethylsilyl)oxy)}-2,2-dimethylpentanoate. Offered by: TRC. Available pack sizes: 500mg, 5g.
Methyl (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethylpentanoate (CAS 218614-13-2) is a chemical compound with the molecular formula C20H44O4Si2 and a molecular weight of 404.7 g/mol. IUPAC name: methyl (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethylpentanoate. InChIKey: HYLBEYMVUAJSHM-INIZCTEOSA-N.
| Molecular formula | C20H44O4Si2 |
|---|---|
| Molecular weight | 404.7 g/mol |
| IUPAC name | methyl (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethylpentanoate |
| InChIKey | HYLBEYMVUAJSHM-INIZCTEOSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H](C(C)(C)C(=O)OC)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)