CAS 2186605-03-6 is the registry number for 1,1'-(5'-(4-(1H-Pyrrol-1-yl)phenyl)-[1,1':3',1''-terphenyl]-4,4''-diyl)bis(1H-pyrrole), 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[4-[3,5-bis(4-pyrrol-1-ylphenyl)phenyl]phenyl]pyrrole (CAS 2186605-03-6) is a chemical compound with the molecular formula C36H27N3 and a molecular weight of 501.6 g/mol. IUPAC name: 1-[4-[3,5-bis(4-pyrrol-1-ylphenyl)phenyl]phenyl]pyrrole. InChIKey: MKUYLXUTGLOFEG-UHFFFAOYSA-N.
| Molecular formula | C36H27N3 |
|---|---|
| Molecular weight | 501.6 g/mol |
| IUPAC name | 1-[4-[3,5-bis(4-pyrrol-1-ylphenyl)phenyl]phenyl]pyrrole |
| InChIKey | MKUYLXUTGLOFEG-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=CC=C(C=C2)C3=CC(=CC(=C3)C4=CC=C(C=C4)N5C=CC=C5)C6=CC=C(C=C6)N7C=CC=C7 |
Computed by PubChem (NCBI)