CAS 1708984-13-7 is the registry number for N1-Phenyl-N2-(4-(9-phenyl-9H-carbazol-3-yl)phenyl)benzene-1,2-diamine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
1-N-phenyl-2-N-[4-(9-phenylcarbazol-3-yl)phenyl]benzene-1,2-diamine (CAS 1708984-13-7) is a chemical compound with the molecular formula C36H27N3 and a molecular weight of 501.6 g/mol. IUPAC name: 1-N-phenyl-2-N-[4-(9-phenylcarbazol-3-yl)phenyl]benzene-1,2-diamine. InChIKey: GSJWCVALKMQUTQ-UHFFFAOYSA-N.
| Molecular formula | C36H27N3 |
|---|---|
| Molecular weight | 501.6 g/mol |
| IUPAC name | 1-N-phenyl-2-N-[4-(9-phenylcarbazol-3-yl)phenyl]benzene-1,2-diamine |
| InChIKey | GSJWCVALKMQUTQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC=C2NC3=CC=C(C=C3)C4=CC5=C(C=C4)N(C6=CC=CC=C65)C7=CC=CC=C7 |
Computed by PubChem (NCBI)