CAS 2187367-11-7 appears in our catalog under these names: Fasnall (benzenesulfonate), Fasnall (benzenesulfonate). Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 500μg, Get quote.
Benzenesulfonic acid;N-(1-benzylpyrrolidin-3-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine (CAS 2187367-11-7) is a chemical compound with the molecular formula C25H28N4O3S2 and a molecular weight of 496.6 g/mol. IUPAC name: benzenesulfonic acid;N-(1-benzylpyrrolidin-3-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine. InChIKey: KLKWHGQIUKBXKT-UHFFFAOYSA-N.
| Molecular formula | C25H28N4O3S2 |
|---|---|
| Molecular weight | 496.6 g/mol |
| IUPAC name | benzenesulfonic acid;N-(1-benzylpyrrolidin-3-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
| InChIKey | KLKWHGQIUKBXKT-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=NC=NC(=C12)NC3CCN(C3)CC4=CC=CC=C4)C.C1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)