CAS 2187426-18-0 is the registry number for rac-Sodium (1R,2S)-2-((pyridin-4-yl)carbamoyl)cyclopropane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Sodium cis-(1R,2S)-2-(pyridin-4-ylcarbamoyl)cyclopropane-1-carboxylate (CAS 2187426-18-0) is a chemical compound with the molecular formula C10H9N2NaO3 and a molecular weight of 228.18 g/mol. IUPAC name: sodium cis-(1R,2S)-2-(pyridin-4-ylcarbamoyl)cyclopropane-1-carboxylate. InChIKey: CCNDOUDKDIDBHC-KZYPOYLOSA-M.
| Molecular formula | C10H9N2NaO3 |
|---|---|
| Molecular weight | 228.18 g/mol |
| IUPAC name | sodium cis-(1R,2S)-2-(pyridin-4-ylcarbamoyl)cyclopropane-1-carboxylate |
| InChIKey | CCNDOUDKDIDBHC-KZYPOYLOSA-M |
| SMILES | C1[C@@H]([C@@H]1C(=O)[O-])C(=O)NC2=CC=NC=C2.[Na+] |
Computed by PubChem (NCBI)