Products 2187426-49-7
CAS 2187426-49-7 is the registry number for 2-Azabicyclo(4.1.0)heptan-1-ylmethanol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[(1S,6R)-2-azabicyclo[4.1.0]heptan-1-yl]methanol;hydrochloride (CAS 2187426-49-7) is a chemical compound with the molecular formula C7H14ClNO and a molecular weight of 163.64 g/mol. IUPAC name: [(1S,6R)-2-azabicyclo[4.1.0]heptan-1-yl]methanol;hydrochloride. InChIKey: WAJIOLZZILUMRN-ZJLYAJKPSA-N.
| Molecular formula | C7H14ClNO |
|---|---|
| Molecular weight | 163.64 g/mol |
| IUPAC name | [(1S,6R)-2-azabicyclo[4.1.0]heptan-1-yl]methanol;hydrochloride |
| InChIKey | WAJIOLZZILUMRN-ZJLYAJKPSA-N |
| SMILES | C1C[C@@H]2C[C@@]2(NC1)CO.Cl |
Computed by PubChem (NCBI)