CAS 2187439-24-1 is the registry number for 2,5,11-Tribromoindolo[3,2,1-jk]carbazole, 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 100mg, 25g, 10g, 1g, 5g, 250mg.
5,10,15-tribromo-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13(18),14,16-nonaene (CAS 2187439-24-1) is a chemical compound with the molecular formula C18H8Br3N and a molecular weight of 478.0 g/mol. IUPAC name: 5,10,15-tribromo-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13(18),14,16-nonaene. InChIKey: PYFROFYQQSCMKR-UHFFFAOYSA-N.
| Molecular formula | C18H8Br3N |
|---|---|
| Molecular weight | 478.0 g/mol |
| IUPAC name | 5,10,15-tribromo-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13(18),14,16-nonaene |
| InChIKey | PYFROFYQQSCMKR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C3=CC(=CC4=C3N2C5=C4C=C(C=C5)Br)Br |
Computed by PubChem (NCBI)