CAS 2188-18-3 appears in our catalog under these names: Boc-Arg(NO2)-OH, 96%, Boc-L-Arg(NO2)-OH, Boc-L-Nitroarginine, >95% (HPLC), Boc–Arg(NO2)–OH, Nalpha-Boc-Nomega-nitro-L-arginine, 98% . Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Iris Biotech. Available pack sizes: 100g, 25g, 5g, on request, 10g, 1g, 250g, 0,05kg.
(2S)-5-[[amino(nitramido)methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 2188-18-3) is a chemical compound with the molecular formula C11H21N5O6 and a molecular weight of 319.31 g/mol. IUPAC name: (2S)-5-[[amino(nitramido)methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: OZSSOVRIEPAIMP-ZETCQYMHSA-N.
| Molecular formula | C11H21N5O6 |
|---|---|
| Molecular weight | 319.31 g/mol |
| IUPAC name | (2S)-5-[[amino(nitramido)methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | OZSSOVRIEPAIMP-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCN=C(N)N[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)