CAS 21888-96-0 is the registry number for Dexetimide (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
(3S)-3-(1-benzylpiperidin-4-yl)-3-phenylpiperidine-2,6-dione;hydrochloride (CAS 21888-96-0) is a chemical compound with the molecular formula C23H27ClN2O2 and a molecular weight of 398.9 g/mol. IUPAC name: (3S)-3-(1-benzylpiperidin-4-yl)-3-phenylpiperidine-2,6-dione;hydrochloride. InChIKey: XSOOSXRNMDUWEM-GNAFDRTKSA-N.
| Molecular formula | C23H27ClN2O2 |
|---|---|
| Molecular weight | 398.9 g/mol |
| IUPAC name | (3S)-3-(1-benzylpiperidin-4-yl)-3-phenylpiperidine-2,6-dione;hydrochloride |
| InChIKey | XSOOSXRNMDUWEM-GNAFDRTKSA-N |
| SMILES | C1CN(CCC1[C@@]2(CCC(=O)NC2=O)C3=CC=CC=C3)CC4=CC=CC=C4.Cl |
Computed by PubChem (NCBI)