CAS 218907-16-5 is the registry number for RGH-1962. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S,3S,4R,5S)-2-(4-nitrophenyl)sulfanylthiane-3,4,5-triol (CAS 218907-16-5) is a chemical compound with the molecular formula C11H13NO5S2 and a molecular weight of 303.4 g/mol. IUPAC name: (2S,3S,4R,5S)-2-(4-nitrophenyl)sulfanylthiane-3,4,5-triol. InChIKey: OPCNOADOCCIZJH-ZNSHCXBVSA-N.
| Molecular formula | C11H13NO5S2 |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | (2S,3S,4R,5S)-2-(4-nitrophenyl)sulfanylthiane-3,4,5-triol |
| InChIKey | OPCNOADOCCIZJH-ZNSHCXBVSA-N |
| SMILES | C1[C@H]([C@H]([C@@H]([C@@H](S1)SC2=CC=C(C=C2)[N+](=O)[O-])O)O)O |
Computed by PubChem (NCBI)