Products 218929-99-8
CAS 218929-99-8 is the registry number for IMM-02. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-tert-butyl-3-[(E)-1-(3,5-difluoro-2-hydroxyphenyl)ethylideneamino]thiourea (CAS 218929-99-8) is a chemical compound with the molecular formula C13H17F2N3OS and a molecular weight of 301.36 g/mol. IUPAC name: 1-tert-butyl-3-[(E)-1-(3,5-difluoro-2-hydroxyphenyl)ethylideneamino]thiourea. InChIKey: LNXOUMUIRMAHEG-REZTVBANSA-N.
| Molecular formula | C13H17F2N3OS |
|---|---|
| Molecular weight | 301.36 g/mol |
| IUPAC name | 1-tert-butyl-3-[(E)-1-(3,5-difluoro-2-hydroxyphenyl)ethylideneamino]thiourea |
| InChIKey | LNXOUMUIRMAHEG-REZTVBANSA-N |
| SMILES | C/C(=N\NC(=S)NC(C)(C)C)/C1=C(C(=CC(=C1)F)F)O |
Computed by PubChem (NCBI)