CAS 218938-68-2 appears in our catalog under these names: H-His(trt)-otbu hydrochloride, 96%, (S)-tert-Butyl 2-amino-3-(1-trityl-1H-imidazol-4-yl)propanoate xhydrochloride, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 250mg, 1g, on request.
Tert-butyl (2S)-2-amino-3-(1-tritylimidazol-4-yl)propanoate;hydrochloride (CAS 218938-68-2) is a chemical compound with the molecular formula C29H32ClN3O2 and a molecular weight of 490.0 g/mol. IUPAC name: tert-butyl (2S)-2-amino-3-(1-tritylimidazol-4-yl)propanoate;hydrochloride. InChIKey: CSJUKIBWBKXMAT-SNYZSRNZSA-N.
| Molecular formula | C29H32ClN3O2 |
|---|---|
| Molecular weight | 490.0 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-3-(1-tritylimidazol-4-yl)propanoate;hydrochloride |
| InChIKey | CSJUKIBWBKXMAT-SNYZSRNZSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CC1=CN(C=N1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)N.Cl |
Computed by PubChem (NCBI)