Products 21895-67-0
CAS 21895-67-0 is the registry number for Hydroxylysinonorleucine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S,5S)-2-amino-6-[(5-amino-5-carboxypentyl)amino]-5-hydroxyhexanoic acid (CAS 21895-67-0) is a chemical compound with the molecular formula C12H25N3O5 and a molecular weight of 291.34 g/mol. IUPAC name: (2S,5S)-2-amino-6-[(5-amino-5-carboxypentyl)amino]-5-hydroxyhexanoic acid. InChIKey: SWTKBYSXMULFHZ-SMILAEQMSA-N.
| Molecular formula | C12H25N3O5 |
|---|---|
| Molecular weight | 291.34 g/mol |
| IUPAC name | (2S,5S)-2-amino-6-[(5-amino-5-carboxypentyl)amino]-5-hydroxyhexanoic acid |
| InChIKey | SWTKBYSXMULFHZ-SMILAEQMSA-N |
| SMILES | C(CCNC[C@H](CC[C@@H](C(=O)O)N)O)CC(C(=O)O)N |
Computed by PubChem (NCBI)