Products 21900-23-2

CAS 21900-23-2 appears in our catalog under these names: 3,4-Dimethylbenzene-1-carbonyl chloride, 96%, 3,4-Dimethylbenzene-1-carbonylchloride 96%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 10g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

3,4-dimethylbenzoyl chloride (CAS 21900-23-2) is a chemical compound with the molecular formula C9H9ClO and a molecular weight of 168.62 g/mol. IUPAC name: 3,4-dimethylbenzoyl chloride. InChIKey: RGAKSNQOIIYQRM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClO
Molecular weight168.62 g/mol
IUPAC name3,4-dimethylbenzoyl chloride
InChIKeyRGAKSNQOIIYQRM-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)C(=O)Cl)C

Computed by PubChem (NCBI)