CAS 2190510-88-2 is the registry number for Sofosbuvir Impurity 134. Offered by: Chemat Brand. Available pack sizes: on request.
Propyl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate (CAS 2190510-88-2) is a chemical compound with the molecular formula C18H17F5NO5P and a molecular weight of 453.3 g/mol. IUPAC name: propyl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate. InChIKey: WWWVYDKVUSXLMD-ZJPIPACBSA-N.
| Molecular formula | C18H17F5NO5P |
|---|---|
| Molecular weight | 453.3 g/mol |
| IUPAC name | propyl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate |
| InChIKey | WWWVYDKVUSXLMD-ZJPIPACBSA-N |
| SMILES | CCCOC(=O)[C@H](C)N[P@](=O)(OC1=CC=CC=C1)OC2=C(C(=C(C(=C2F)F)F)F)F |
Computed by PubChem (NCBI)