CAS 21907-50-6 appears in our catalog under these names: Cesium trifluoroacetate, 95%, Cesium Trifluoroacetate, Cesium trifluoroacetate, Cesium trifluoroacetate , Caesium trifluoroacetate. Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 25g, 1g, 5g, 500mg, 10g, 50g, 2g.
Cesium 2,2,2-trifluoroacetate (CAS 21907-50-6) is a chemical compound with the molecular formula C2CsF3O2 and a molecular weight of 245.92 g/mol. IUPAC name: cesium 2,2,2-trifluoroacetate. InChIKey: RJYSYRSELCQCSO-UHFFFAOYSA-M.
| Molecular formula | C2CsF3O2 |
|---|---|
| Molecular weight | 245.92 g/mol |
| IUPAC name | cesium 2,2,2-trifluoroacetate |
| InChIKey | RJYSYRSELCQCSO-UHFFFAOYSA-M |
| SMILES | C(=O)(C(F)(F)F)[O-].[Cs+] |
Computed by PubChem (NCBI)