CAS 2193059-20-8 is the registry number for 5-(dimethylamino)pyridine-2-sulfinate lithium. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Lithium 5-(dimethylamino)pyridine-2-sulfinate (CAS 2193059-20-8) is a chemical compound with the molecular formula C7H9LiN2O2S and a molecular weight of 192.2 g/mol. IUPAC name: lithium 5-(dimethylamino)pyridine-2-sulfinate. InChIKey: KSINNQYWPXHUJS-UHFFFAOYSA-M.
| Molecular formula | C7H9LiN2O2S |
|---|---|
| Molecular weight | 192.2 g/mol |
| IUPAC name | lithium 5-(dimethylamino)pyridine-2-sulfinate |
| InChIKey | KSINNQYWPXHUJS-UHFFFAOYSA-M |
| SMILES | [Li+].CN(C)C1=CN=C(C=C1)S(=O)[O-] |
Computed by PubChem (NCBI)