CAS 21947-32-0 appears in our catalog under these names: Boc–Nle–OH·DCHA, Boc-L-Nle-OH*DCHA, Boc-L-norleucine dicyclohexylammonium salt, Boc-Nle-OH·DCHA 97%, Boc-Nle-OH DCHA, 97%, 97%. Offered by: GLPBio, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 2g, 10g, 500g, 100g.
N-cyclohexylcyclohexanamine;(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 21947-32-0) is a chemical compound with the molecular formula C23H44N2O4 and a molecular weight of 412.6 g/mol. IUPAC name: N-cyclohexylcyclohexanamine;(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: BFEVJIUEBDZIJQ-WDBKTSHHSA-N.
| Molecular formula | C23H44N2O4 |
|---|---|
| Molecular weight | 412.6 g/mol |
| IUPAC name | N-cyclohexylcyclohexanamine;(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | BFEVJIUEBDZIJQ-WDBKTSHHSA-N |
| SMILES | CCCC[C@@H](C(=O)O)NC(=O)OC(C)(C)C.C1CCC(CC1)NC2CCCCC2 |
Computed by PubChem (NCBI)