CAS 21947-98-8 appears in our catalog under these names: N-Boc-S-trityl-L-cysteine, 98%, 98%, Boc-Cys(Trt)-OH 98%, Boc-Cys(Trt)-OH, 98%, Boc-Cys(Trt)-OH, 97%, Boc-Cys(Trt)-OH, >95% (HPLC). Offered by: Chemat, Ambeed, Combi-blocks, TRC, GLPBio. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1kg, 1000g, 1g.
2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoic acid (CAS 21947-98-8) is a chemical compound with the molecular formula C27H29NO4S and a molecular weight of 463.6 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoic acid. InChIKey: JDTOWOURWBDELG-UHFFFAOYSA-N.
| Molecular formula | C27H29NO4S |
|---|---|
| Molecular weight | 463.6 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoic acid |
| InChIKey | JDTOWOURWBDELG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CSC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)