Products 219521-60-5
CAS 219521-60-5 is the registry number for ((4-nitrophenyl)amino)((2-phenylethyl)amino)methane-1-thione. Offered by: Biosynth. Available pack sizes: 250mg.
1-(4-nitrophenyl)-3-(2-phenylethyl)thiourea (CAS 219521-60-5) is a chemical compound with the molecular formula C15H15N3O2S and a molecular weight of 301.4 g/mol. IUPAC name: 1-(4-nitrophenyl)-3-(2-phenylethyl)thiourea. InChIKey: PJOLZDYSBDFJSY-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O2S |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | 1-(4-nitrophenyl)-3-(2-phenylethyl)thiourea |
| InChIKey | PJOLZDYSBDFJSY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCNC(=S)NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)