CAS 2195336-17-3 appears in our catalog under these names: Aztreonam Impurity 38, Aztreonam Impurity 5. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 10mg, 5mg.
(2S,3S)-2-amino-3-(sulfoamino)butanoic acid (CAS 2195336-17-3) is a chemical compound with the molecular formula C4H10N2O5S and a molecular weight of 198.20 g/mol. IUPAC name: (2S,3S)-2-amino-3-(sulfoamino)butanoic acid. InChIKey: YDNXUOFNHVZGLS-HRFVKAFMSA-N.
| Molecular formula | C4H10N2O5S |
|---|---|
| Molecular weight | 198.20 g/mol |
| IUPAC name | (2S,3S)-2-amino-3-(sulfoamino)butanoic acid |
| InChIKey | YDNXUOFNHVZGLS-HRFVKAFMSA-N |
| SMILES | C[C@@H]([C@@H](C(=O)O)N)NS(=O)(=O)O |
Computed by PubChem (NCBI)