CAS 219537-08-3 is the registry number for 9-Chloro-2-benzyl-1,2,3,4-tetrahydro-2-azaacridine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-benzyl-10-chloro-3,4-dihydro-1H-benzo[b][1,6]naphthyridine (CAS 219537-08-3) is a chemical compound with the molecular formula C19H17ClN2 and a molecular weight of 308.8 g/mol. IUPAC name: 2-benzyl-10-chloro-3,4-dihydro-1H-benzo[b][1,6]naphthyridine. InChIKey: BSBOXQXOZZHMDR-UHFFFAOYSA-N.
| Molecular formula | C19H17ClN2 |
|---|---|
| Molecular weight | 308.8 g/mol |
| IUPAC name | 2-benzyl-10-chloro-3,4-dihydro-1H-benzo[b][1,6]naphthyridine |
| InChIKey | BSBOXQXOZZHMDR-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C(C3=CC=CC=C3N=C21)Cl)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)