Products 219544-52-2

CAS 219544-52-2 is the registry number for [1-(4-Chlorobenzyl)-1h-indol-3-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[1-[(4-chlorophenyl)methyl]indol-3-yl]acetic acid (CAS 219544-52-2) is a chemical compound with the molecular formula C17H14ClNO2 and a molecular weight of 299.7 g/mol. IUPAC name: 2-[1-[(4-chlorophenyl)methyl]indol-3-yl]acetic acid. InChIKey: HCSJKRALCMDCMF-UHFFFAOYSA-N.

Identity
Molecular formulaC17H14ClNO2
Molecular weight299.7 g/mol
IUPAC name2-[1-[(4-chlorophenyl)methyl]indol-3-yl]acetic acid
InChIKeyHCSJKRALCMDCMF-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=CN2CC3=CC=C(C=C3)Cl)CC(=O)O

Computed by PubChem (NCBI)