Products 219547-77-0

CAS 219547-77-0 is the registry number for tert-Butyl 3-(trichloromethyl)oxaziridine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl 3-(trichloromethyl)oxaziridine-2-carboxylate (CAS 219547-77-0) is a chemical compound with the molecular formula C7H10Cl3NO3 and a molecular weight of 262.5 g/mol. IUPAC name: tert-butyl 3-(trichloromethyl)oxaziridine-2-carboxylate. InChIKey: RKQBULMPIKTIOE-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10Cl3NO3
Molecular weight262.5 g/mol
IUPAC nametert-butyl 3-(trichloromethyl)oxaziridine-2-carboxylate
InChIKeyRKQBULMPIKTIOE-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1C(O1)C(Cl)(Cl)Cl

Computed by PubChem (NCBI)