Products 219581-36-9
CAS 219581-36-9 is the registry number for Alvameline (maleate). Offered by: MedChemExpress. Available pack sizes: Get quote.
(Z)-but-2-enedioic acid;5-(2-ethyltetrazol-5-yl)-1-methyl-3,6-dihydro-2H-pyridine (CAS 219581-36-9) is a chemical compound with the molecular formula C13H19N5O4 and a molecular weight of 309.32 g/mol. IUPAC name: (Z)-but-2-enedioic acid;5-(2-ethyltetrazol-5-yl)-1-methyl-3,6-dihydro-2H-pyridine. InChIKey: YKFYFAAWVQGVTP-BTJKTKAUSA-N.
| Molecular formula | C13H19N5O4 |
|---|---|
| Molecular weight | 309.32 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;5-(2-ethyltetrazol-5-yl)-1-methyl-3,6-dihydro-2H-pyridine |
| InChIKey | YKFYFAAWVQGVTP-BTJKTKAUSA-N |
| SMILES | CCN1N=C(N=N1)C2=CCCN(C2)C.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)