Products 219583-10-5
CAS 219583-10-5 appears in our catalog under these names: Zafirlukast Impurity 4, Zafirlukast M1 Metabolite, Zafirlukast metabolite M1. Offered by: Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, Get quote.
4-[(5-amino-1-methylindol-3-yl)methyl]-3-methoxy-N-(2-methylphenyl)sulfonylbenzamide (CAS 219583-10-5) is a chemical compound with the molecular formula C25H25N3O4S and a molecular weight of 463.6 g/mol. IUPAC name: 4-[(5-amino-1-methylindol-3-yl)methyl]-3-methoxy-N-(2-methylphenyl)sulfonylbenzamide. InChIKey: HNBZIIQASMYNPG-UHFFFAOYSA-N.
| Molecular formula | C25H25N3O4S |
|---|---|
| Molecular weight | 463.6 g/mol |
| IUPAC name | 4-[(5-amino-1-methylindol-3-yl)methyl]-3-methoxy-N-(2-methylphenyl)sulfonylbenzamide |
| InChIKey | HNBZIIQASMYNPG-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1S(=O)(=O)NC(=O)C2=CC(=C(C=C2)CC3=CN(C4=C3C=C(C=C4)N)C)OC |
Computed by PubChem (NCBI)