Products 2196182-47-3

CAS 2196182-47-3 appears in our catalog under these names: Lubiprostone Impurity 1, Lubiprostone Impurity 2. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 0,5mg, 2,5mg, 5mg.

Structural formula: {0} (CAS {1})

7-[(1R,2S)-2-(4,4-difluoro-3-oxooctyl)-5-oxocyclopent-3-en-1-yl]heptanoic acid (CAS 2196182-47-3) is a chemical compound with the molecular formula C20H30F2O4 and a molecular weight of 372.4 g/mol. IUPAC name: 7-[(1R,2S)-2-(4,4-difluoro-3-oxooctyl)-5-oxocyclopent-3-en-1-yl]heptanoic acid. InChIKey: CNRMSAXGFGQPGP-HZPDHXFCSA-N.

Identity
Molecular formulaC20H30F2O4
Molecular weight372.4 g/mol
IUPAC name7-[(1R,2S)-2-(4,4-difluoro-3-oxooctyl)-5-oxocyclopent-3-en-1-yl]heptanoic acid
InChIKeyCNRMSAXGFGQPGP-HZPDHXFCSA-N
SMILESCCCCC(C(=O)CC[C@H]1C=CC(=O)[C@@H]1CCCCCCC(=O)O)(F)F

Computed by PubChem (NCBI)