CAS 2196245-16-4 appears in our catalog under these names: Lp-PLA2-IN-3, 98%, Lp-PLA2-IN-3/ 99.49% (existing batch purity), Lp–PLA2–IN–3, Lp-PLA2-IN-3, Lp-PLA2-IN-3, 99.94%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 500mg.
4-amino-N-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-3-cyanophenyl]benzenesulfonamide (CAS 2196245-16-4) is a chemical compound with the molecular formula C20H13ClF3N3O3S and a molecular weight of 467.8 g/mol. IUPAC name: 4-amino-N-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-3-cyanophenyl]benzenesulfonamide. InChIKey: GADGQEKPNKSGMT-UHFFFAOYSA-N.
| Molecular formula | C20H13ClF3N3O3S |
|---|---|
| Molecular weight | 467.8 g/mol |
| IUPAC name | 4-amino-N-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-3-cyanophenyl]benzenesulfonamide |
| InChIKey | GADGQEKPNKSGMT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)NC2=CC(=C(C=C2)OC3=CC(=C(C=C3)Cl)C(F)(F)F)C#N |
Computed by PubChem (NCBI)