CAS 219689-82-4 is the registry number for 3-(4-Bromo-2-thienyl)-1-(4-chlorophenyl)prop-2-en-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
(E)-3-(4-bromothiophen-2-yl)-1-(4-chlorophenyl)prop-2-en-1-one (CAS 219689-82-4) is a chemical compound with the molecular formula C13H8BrClOS and a molecular weight of 327.62 g/mol. IUPAC name: (E)-3-(4-bromothiophen-2-yl)-1-(4-chlorophenyl)prop-2-en-1-one. InChIKey: PSSJEANURYCSPI-AATRIKPKSA-N.
| Molecular formula | C13H8BrClOS |
|---|---|
| Molecular weight | 327.62 g/mol |
| IUPAC name | (E)-3-(4-bromothiophen-2-yl)-1-(4-chlorophenyl)prop-2-en-1-one |
| InChIKey | PSSJEANURYCSPI-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1C(=O)/C=C/C2=CC(=CS2)Br)Cl |
Computed by PubChem (NCBI)