CAS 219691-94-8 appears in our catalog under these names: 2-(3,5-Dichloro-4-(4-hydroxy-3-isopropylphenoxy)phenyl)acetic acid, 98%, KB-141. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
2-[3,5-dichloro-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]acetic acid (CAS 219691-94-8) is a chemical compound with the molecular formula C17H16Cl2O4 and a molecular weight of 355.2 g/mol. IUPAC name: 2-[3,5-dichloro-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]acetic acid. InChIKey: OZYQIQVPUZANTM-UHFFFAOYSA-N.
| Molecular formula | C17H16Cl2O4 |
|---|---|
| Molecular weight | 355.2 g/mol |
| IUPAC name | 2-[3,5-dichloro-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]acetic acid |
| InChIKey | OZYQIQVPUZANTM-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=CC(=C1)OC2=C(C=C(C=C2Cl)CC(=O)O)Cl)O |
Computed by PubChem (NCBI)