CAS 2197053-07-7 is the registry number for Cyclopropyl[5-(trifluoromethyl)pyridin-3-yl]methanamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
Cyclopropyl-[5-(trifluoromethyl)-3-pyridinyl]methanamine;dihydrochloride (CAS 2197053-07-7) is a chemical compound with the molecular formula C10H13Cl2F3N2 and a molecular weight of 289.12 g/mol. IUPAC name: cyclopropyl-[5-(trifluoromethyl)-3-pyridinyl]methanamine;dihydrochloride. InChIKey: AWZKALDJNHZOOH-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2F3N2 |
|---|---|
| Molecular weight | 289.12 g/mol |
| IUPAC name | cyclopropyl-[5-(trifluoromethyl)-3-pyridinyl]methanamine;dihydrochloride |
| InChIKey | AWZKALDJNHZOOH-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2=CC(=CN=C2)C(F)(F)F)N.Cl.Cl |
Computed by PubChem (NCBI)