CAS 2197057-18-2 is the registry number for Lithium 1-ethyl-5-fluoro-1h-benzo[d]imidazole-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
Lithium 1-ethyl-5-fluorobenzimidazole-2-carboxylate (CAS 2197057-18-2) is a chemical compound with the molecular formula C10H8FLiN2O2 and a molecular weight of 214.1 g/mol. IUPAC name: lithium 1-ethyl-5-fluorobenzimidazole-2-carboxylate. InChIKey: MOVWSQQCIZOPBH-UHFFFAOYSA-M.
| Molecular formula | C10H8FLiN2O2 |
|---|---|
| Molecular weight | 214.1 g/mol |
| IUPAC name | lithium 1-ethyl-5-fluorobenzimidazole-2-carboxylate |
| InChIKey | MOVWSQQCIZOPBH-UHFFFAOYSA-M |
| SMILES | [Li+].CCN1C2=C(C=C(C=C2)F)N=C1C(=O)[O-] |
Computed by PubChem (NCBI)