CAS 2197057-64-8 is the registry number for Lithium 7-fluoro-1-methyl-1H-benzo(d)imidazole-2-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
Lithium 7-fluoro-1-methylbenzimidazole-2-carboxylate (CAS 2197057-64-8) is a chemical compound with the molecular formula C9H6FLiN2O2 and a molecular weight of 200.1 g/mol. IUPAC name: lithium 7-fluoro-1-methylbenzimidazole-2-carboxylate. InChIKey: CXVYKKHCJOYMAS-UHFFFAOYSA-M.
| Molecular formula | C9H6FLiN2O2 |
|---|---|
| Molecular weight | 200.1 g/mol |
| IUPAC name | lithium 7-fluoro-1-methylbenzimidazole-2-carboxylate |
| InChIKey | CXVYKKHCJOYMAS-UHFFFAOYSA-M |
| SMILES | [Li+].CN1C2=C(C=CC=C2F)N=C1C(=O)[O-] |
Computed by PubChem (NCBI)