CAS 2197062-33-0 is the registry number for Lithium 5-fluoro-1-((tetrahydro-2H-pyran-4-yl)methyl)-1H-benzo(d)imidazole-2-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
Lithium 5-fluoro-1-(oxan-4-ylmethyl)benzimidazole-2-carboxylate (CAS 2197062-33-0) is a chemical compound with the molecular formula C14H14FLiN2O3 and a molecular weight of 284.2 g/mol. IUPAC name: lithium 5-fluoro-1-(oxan-4-ylmethyl)benzimidazole-2-carboxylate. InChIKey: FVCFYTSCTUWBTJ-UHFFFAOYSA-M.
| Molecular formula | C14H14FLiN2O3 |
|---|---|
| Molecular weight | 284.2 g/mol |
| IUPAC name | lithium 5-fluoro-1-(oxan-4-ylmethyl)benzimidazole-2-carboxylate |
| InChIKey | FVCFYTSCTUWBTJ-UHFFFAOYSA-M |
| SMILES | [Li+].C1COCCC1CN2C3=C(C=C(C=C3)F)N=C2C(=O)[O-] |
Computed by PubChem (NCBI)