CAS 219767-11-0 is the registry number for 6-(tert-Butyl)-2-ethylimidazo[2,1-b][1,3,4]thiadiazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-tert-butyl-2-ethylimidazo[2,1-b][1,3,4]thiadiazole (CAS 219767-11-0) is a chemical compound with the molecular formula C10H15N3S and a molecular weight of 209.31 g/mol. IUPAC name: 6-tert-butyl-2-ethylimidazo[2,1-b][1,3,4]thiadiazole. InChIKey: WKZXBIPDYYJOET-UHFFFAOYSA-N.
| Molecular formula | C10H15N3S |
|---|---|
| Molecular weight | 209.31 g/mol |
| IUPAC name | 6-tert-butyl-2-ethylimidazo[2,1-b][1,3,4]thiadiazole |
| InChIKey | WKZXBIPDYYJOET-UHFFFAOYSA-N |
| SMILES | CCC1=NN2C=C(N=C2S1)C(C)(C)C |
Computed by PubChem (NCBI)