Products 219834-66-9
CAS 219834-66-9 is the registry number for tert-Butyl (1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)carbamate (CAS 219834-66-9) is a chemical compound with the molecular formula C11H18F3NO3 and a molecular weight of 269.26 g/mol. IUPAC name: tert-butyl N-(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)carbamate. InChIKey: KYTKVLLJAXHCTM-UHFFFAOYSA-N.
| Molecular formula | C11H18F3NO3 |
|---|---|
| Molecular weight | 269.26 g/mol |
| IUPAC name | tert-butyl N-(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)carbamate |
| InChIKey | KYTKVLLJAXHCTM-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)C(F)(F)F)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)