CAS 219865-96-0 is the registry number for 6-(2,4-Difluorophenoxy)pyridin-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 25g.
2-(2,4-difluorophenoxy)-5-nitropyridine (CAS 219865-96-0) is a chemical compound with the molecular formula C11H6F2N2O3 and a molecular weight of 252.17 g/mol. IUPAC name: 2-(2,4-difluorophenoxy)-5-nitropyridine. InChIKey: VNVUVVNYXQZPNA-UHFFFAOYSA-N.
| Molecular formula | C11H6F2N2O3 |
|---|---|
| Molecular weight | 252.17 g/mol |
| IUPAC name | 2-(2,4-difluorophenoxy)-5-nitropyridine |
| InChIKey | VNVUVVNYXQZPNA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)OC2=NC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)