CAS 2199288-66-7 is the registry number for tert-Butyl 4-((4-fluoro-N-methylphenyl)sulfonamido)piperidine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 4-[(4-fluorophenyl)sulfonyl-methylamino]piperidine-1-carboxylate (CAS 2199288-66-7) is a chemical compound with the molecular formula C17H25FN2O4S and a molecular weight of 372.5 g/mol. IUPAC name: tert-butyl 4-[(4-fluorophenyl)sulfonyl-methylamino]piperidine-1-carboxylate. InChIKey: WGUGNGNYDUFQIM-UHFFFAOYSA-N.
| Molecular formula | C17H25FN2O4S |
|---|---|
| Molecular weight | 372.5 g/mol |
| IUPAC name | tert-butyl 4-[(4-fluorophenyl)sulfonyl-methylamino]piperidine-1-carboxylate |
| InChIKey | WGUGNGNYDUFQIM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)N(C)S(=O)(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)