CAS 219939-04-5 is the registry number for 3-(2-Fluoro-4-hydroxyphenyl)-5-(trifluoromethyl)-4-Isoxazolecarboxylic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 250mg.
Methyl 3-(2-fluoro-4-hydroxyphenyl)-5-(trifluoromethyl)-1,2-oxazole-4-carboxylate (CAS 219939-04-5) is a chemical compound with the molecular formula C12H7F4NO4 and a molecular weight of 305.18 g/mol. IUPAC name: methyl 3-(2-fluoro-4-hydroxyphenyl)-5-(trifluoromethyl)-1,2-oxazole-4-carboxylate. InChIKey: RJAHITOQOQAJFP-UHFFFAOYSA-N.
| Molecular formula | C12H7F4NO4 |
|---|---|
| Molecular weight | 305.18 g/mol |
| IUPAC name | methyl 3-(2-fluoro-4-hydroxyphenyl)-5-(trifluoromethyl)-1,2-oxazole-4-carboxylate |
| InChIKey | RJAHITOQOQAJFP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(ON=C1C2=C(C=C(C=C2)O)F)C(F)(F)F |
Computed by PubChem (NCBI)