Products 2199484-98-3

CAS 2199484-98-3 is the registry number for 3,5-Bis(4-carboxyphenyl)pyridine 1-oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-[5-(4-carboxyphenyl)-1-oxidopyridin-1-ium-3-yl]benzoic acid (CAS 2199484-98-3) is a chemical compound with the molecular formula C19H13NO5 and a molecular weight of 335.3 g/mol. IUPAC name: 4-[5-(4-carboxyphenyl)-1-oxidopyridin-1-ium-3-yl]benzoic acid. InChIKey: MCVMTFNNZUDPRL-UHFFFAOYSA-N.

Identity
Molecular formulaC19H13NO5
Molecular weight335.3 g/mol
IUPAC name4-[5-(4-carboxyphenyl)-1-oxidopyridin-1-ium-3-yl]benzoic acid
InChIKeyMCVMTFNNZUDPRL-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=CC(=C[N+](=C2)[O-])C3=CC=C(C=C3)C(=O)O)C(=O)O

Computed by PubChem (NCBI)