CAS 2199484-98-3 is the registry number for 3,5-Bis(4-carboxyphenyl)pyridine 1-oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[5-(4-carboxyphenyl)-1-oxidopyridin-1-ium-3-yl]benzoic acid (CAS 2199484-98-3) is a chemical compound with the molecular formula C19H13NO5 and a molecular weight of 335.3 g/mol. IUPAC name: 4-[5-(4-carboxyphenyl)-1-oxidopyridin-1-ium-3-yl]benzoic acid. InChIKey: MCVMTFNNZUDPRL-UHFFFAOYSA-N.
| Molecular formula | C19H13NO5 |
|---|---|
| Molecular weight | 335.3 g/mol |
| IUPAC name | 4-[5-(4-carboxyphenyl)-1-oxidopyridin-1-ium-3-yl]benzoic acid |
| InChIKey | MCVMTFNNZUDPRL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C[N+](=C2)[O-])C3=CC=C(C=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)