CAS 219949-90-3 appears in our catalog under these names: Methyl 4-chloro-8-fluoroquinoline-2-carboxylate, 95%, Methyl 4-chloro-8-fluoroquinoline-2-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 250mg, 2,5g.
4-chloro-8-fluoro-3-methylquinoline-2-carboxylate (CAS 219949-90-3) is a chemical compound with the molecular formula C11H6ClFNO2- and a molecular weight of 238.62 g/mol. IUPAC name: 4-chloro-8-fluoro-3-methylquinoline-2-carboxylate. InChIKey: WSOLBSOOCPGCMA-UHFFFAOYSA-M.
| Molecular formula | C11H6ClFNO2- |
|---|---|
| Molecular weight | 238.62 g/mol |
| IUPAC name | 4-chloro-8-fluoro-3-methylquinoline-2-carboxylate |
| InChIKey | WSOLBSOOCPGCMA-UHFFFAOYSA-M |
| SMILES | CC1=C(C2=C(C(=CC=C2)F)N=C1C(=O)[O-])Cl |
Computed by PubChem (NCBI)