Products 219998-24-0
CAS 219998-24-0 is the registry number for Severibuxine. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
3,3-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-6-hydroxy-1H-quinoline-2,4-dione (CAS 219998-24-0) is a chemical compound with the molecular formula C29H39NO3 and a molecular weight of 449.6 g/mol. IUPAC name: 3,3-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-6-hydroxy-1H-quinoline-2,4-dione. InChIKey: SHPNXUNENDVMRG-QAOSGDJLSA-N.
| Molecular formula | C29H39NO3 |
|---|---|
| Molecular weight | 449.6 g/mol |
| IUPAC name | 3,3-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-6-hydroxy-1H-quinoline-2,4-dione |
| InChIKey | SHPNXUNENDVMRG-QAOSGDJLSA-N |
| SMILES | CC(=CCC/C(=C/CC1(C(=O)NC2=C(C1=O)C=C(C=C2)O)C/C=C(/CCC=C(C)C)\C)/C)C |
Computed by PubChem (NCBI)