CAS 2200269-27-6 is the registry number for 7-Deaza-2'-deoxy-7-ethynyladenosine. Offered by: Biosynth. Available pack sizes: 10mg.
5-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-2-(hydroxymethyl)oxolan-3-ol (CAS 2200269-27-6) is a chemical compound with the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. IUPAC name: 5-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-2-(hydroxymethyl)oxolan-3-ol. InChIKey: GZARBPWCGUWKQZ-UHFFFAOYSA-N.
| Molecular formula | C13H14N4O3 |
|---|---|
| Molecular weight | 274.28 g/mol |
| IUPAC name | 5-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | GZARBPWCGUWKQZ-UHFFFAOYSA-N |
| SMILES | C#CC1=CN(C2=NC=NC(=C12)N)C3CC(C(O3)CO)O |
Computed by PubChem (NCBI)