CAS 220031-86-7 is the registry number for Ertapenem Impurity DIPP. Offered by: Chemat Brand. Available pack sizes: on request.
3-[[(2S,4S)-1-di(propan-2-yloxy)phosphoryl-4-sulfanylpyrrolidine-2-carbonyl]amino]benzoic acid (CAS 220031-86-7) is a chemical compound with the molecular formula C18H27N2O6PS and a molecular weight of 430.5 g/mol. IUPAC name: 3-[[(2S,4S)-1-di(propan-2-yloxy)phosphoryl-4-sulfanylpyrrolidine-2-carbonyl]amino]benzoic acid. InChIKey: CKLWFRGLRHJOQP-HOTGVXAUSA-N.
| Molecular formula | C18H27N2O6PS |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | 3-[[(2S,4S)-1-di(propan-2-yloxy)phosphoryl-4-sulfanylpyrrolidine-2-carbonyl]amino]benzoic acid |
| InChIKey | CKLWFRGLRHJOQP-HOTGVXAUSA-N |
| SMILES | CC(C)OP(=O)(N1C[C@H](C[C@H]1C(=O)NC2=CC=CC(=C2)C(=O)O)S)OC(C)C |
Computed by PubChem (NCBI)