CAS 2200552-24-3 is the registry number for (R)-4-(3-Bromophenyl)-6,8-dichloro-2-methyl-1,2,3,4-tetrahydroisoquinoline, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(4R)-4-(3-bromophenyl)-6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinoline (CAS 2200552-24-3) is a chemical compound with the molecular formula C16H14BrCl2N and a molecular weight of 371.1 g/mol. IUPAC name: (4R)-4-(3-bromophenyl)-6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinoline. InChIKey: LJCWTVCXFOSCRP-CQSZACIVSA-N.
| Molecular formula | C16H14BrCl2N |
|---|---|
| Molecular weight | 371.1 g/mol |
| IUPAC name | (4R)-4-(3-bromophenyl)-6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinoline |
| InChIKey | LJCWTVCXFOSCRP-CQSZACIVSA-N |
| SMILES | CN1C[C@@H](C2=C(C1)C(=CC(=C2)Cl)Cl)C3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)