Products 22006-84-4
CAS 22006-84-4 is the registry number for Denopterin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[[4-[1-(2-amino-4-oxo-3H-pteridin-6-yl)ethyl-methylamino]benzoyl]amino]pentanedioic acid (CAS 22006-84-4) is a chemical compound with the molecular formula C21H23N7O6 and a molecular weight of 469.5 g/mol. IUPAC name: (2S)-2-[[4-[1-(2-amino-4-oxo-3H-pteridin-6-yl)ethyl-methylamino]benzoyl]amino]pentanedioic acid. InChIKey: FLWWDYNPWOSLEO-HQVZTVAUSA-N.
| Molecular formula | C21H23N7O6 |
|---|---|
| Molecular weight | 469.5 g/mol |
| IUPAC name | (2S)-2-[[4-[1-(2-amino-4-oxo-3H-pteridin-6-yl)ethyl-methylamino]benzoyl]amino]pentanedioic acid |
| InChIKey | FLWWDYNPWOSLEO-HQVZTVAUSA-N |
| SMILES | CC(C1=CN=C2C(=N1)C(=O)NC(=N2)N)N(C)C3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)